C16H12F2N2O2S — CID 16911522
N-(4,6-difluoro-1,3-benzothiazol-2-yl)-2-(3-methoxyphenyl)acetamide (PubChem CID 16911522) has the molecular formula C16H12F2N2O2S and a molecular weight of 334.35 g/mol. Its IUPAC name is N-(4,6-difluoro-1,3-benzothiazol-2-yl)-2-(3-methoxyphenyl)acetamide.
| Compound Name | N-(4,6-difluoro-1,3-benzothiazol-2-yl)-2-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 16911522 |
| Molecular Formula | C16H12F2N2O2S |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | N-(4,6-difluoro-1,3-benzothiazol-2-yl)-2-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(CC(=O)Nc2nc3c(F)cc(F)cc3s2)c1 |
| InChI | InChI=1S/C16H12F2N2O2S/c1-22-11-4-2-3-9(5-11)6-14(21)19-16-20-15-12(18)7-10(17)8-13(15)23-16/h2-5,7-8H,6H2,1H3,(H,19,20,21) |
| InChIKey | KGASBLXVJXIJIL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |