C17H12F2N2O2S — CID 3560638
N-(4,6-difluoro-1,3-benzothiazol-2-yl)-3-(3-methoxyphenyl)prop-2-enamide (PubChem CID 3560638) has the molecular formula C17H12F2N2O2S and a molecular weight of 346.36 g/mol. Its IUPAC name is N-(4,6-difluoro-1,3-benzothiazol-2-yl)-3-(3-methoxyphenyl)prop-2-enamide.
| Compound Name | N-(4,6-difluoro-1,3-benzothiazol-2-yl)-3-(3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3560638 |
| Molecular Formula | C17H12F2N2O2S |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | N-(4,6-difluoro-1,3-benzothiazol-2-yl)-3-(3-methoxyphenyl)prop-2-enamide |
| SMILES | COc1cccc(C=CC(=O)Nc2nc3c(F)cc(F)cc3s2)c1 |
| InChI | InChI=1S/C17H12F2N2O2S/c1-23-12-4-2-3-10(7-12)5-6-15(22)20-17-21-16-13(19)8-11(18)9-14(16)24-17/h2-9H,1H3,(H,20,21,22) |
| InChIKey | HRURUIQNWWDORB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|