C16H9ClF2N2OS — CID 7193228
3-(2-chlorophenyl)-N-(4,6-difluoro-1,3-benzothiazol-2-yl)prop-2-enamide (PubChem CID 7193228) has the molecular formula C16H9ClF2N2OS and a molecular weight of 350.78 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-(4,6-difluoro-1,3-benzothiazol-2-yl)prop-2-enamide.
| Compound Name | 3-(2-chlorophenyl)-N-(4,6-difluoro-1,3-benzothiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 7193228 |
| Molecular Formula | C16H9ClF2N2OS |
| Molecular Weight | 350.78 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | 3-(2-chlorophenyl)-N-(4,6-difluoro-1,3-benzothiazol-2-yl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1Cl)Nc1nc2c(F)cc(F)cc2s1 |
| InChI | InChI=1S/C16H9ClF2N2OS/c17-11-4-2-1-3-9(11)5-6-14(22)20-16-21-15-12(19)7-10(18)8-13(15)23-16/h1-8H,(H,20,21,22) |
| InChIKey | QGLMNBLQHPIZQD-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.78 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|