C17H10ClF3N2OS — CID 18863115
(E)-N-(1,3-benzothiazol-2-yl)-3-[2-chloro-5-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 18863115) has the molecular formula C17H10ClF3N2OS and a molecular weight of 382.79 g/mol. Its IUPAC name is (E)-N-(1,3-benzothiazol-2-yl)-3-[2-chloro-5-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(1,3-benzothiazol-2-yl)-3-[2-chloro-5-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 18863115 |
| Molecular Formula | C17H10ClF3N2OS |
| Molecular Weight | 382.79 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | (E)-N-(1,3-benzothiazol-2-yl)-3-[2-chloro-5-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(C(F)(F)F)ccc1Cl)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H10ClF3N2OS/c18-12-7-6-11(17(19,20)21)9-10(12)5-8-15(24)23-16-22-13-3-1-2-4-14(13)25-16/h1-9H,(H,22,23,24)/b8-5+ |
| InChIKey | ACOGPIFKBDKJBX-VMPITWQZSA-N |
| XLogP | 5.62 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.79 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|