C15H10F3N3OS — CID 175678594
1-(1,3-benzothiazol-2-yl)-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 175678594) has the molecular formula C15H10F3N3OS and a molecular weight of 337.33 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 175678594 |
| Molecular Formula | C15H10F3N3OS |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C15H10F3N3OS/c16-15(17,18)9-5-7-10(8-6-9)19-13(22)21-14-20-11-3-1-2-4-12(11)23-14/h1-8H,(H2,19,20,21,22) |
| InChIKey | MUDXNMBQUFEFLH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |