C10H8F3N3OS — CID 146255562
1-methyl-3-[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]urea (PubChem CID 146255562) has the molecular formula C10H8F3N3OS and a molecular weight of 275.26 g/mol. Its IUPAC name is 1-methyl-3-[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]urea.
| Compound Name | 1-methyl-3-[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]urea |
|---|---|
| PubChem CID | 146255562 |
| Molecular Formula | C10H8F3N3OS |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 1-methyl-3-[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]urea |
| SMILES | CNC(=O)Nc1nc2ccc(C(F)(F)F)cc2s1 |
| InChI | InChI=1S/C10H8F3N3OS/c1-14-8(17)16-9-15-6-3-2-5(10(11,12)13)4-7(6)18-9/h2-4H,1H3,(H2,14,15,16,17) |
| InChIKey | JAXMOLXAHINWHW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |