C11H10F3N5OS — CID 143516371
1-(2-amino-2-iminoethyl)-3-[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]urea (PubChem CID 143516371) has the molecular formula C11H10F3N5OS and a molecular weight of 317.30 g/mol. Its IUPAC name is 1-(2-amino-2-iminoethyl)-3-[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]urea.
| Compound Name | 1-(2-amino-2-iminoethyl)-3-[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]urea |
|---|---|
| PubChem CID | 143516371 |
| Molecular Formula | C11H10F3N5OS |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 1-(2-amino-2-iminoethyl)-3-[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]urea |
| SMILES | [H]/N=C(\N)CNC(=O)Nc1nc2ccc(C(F)(F)F)cc2s1 |
| InChI | InChI=1S/C11H10F3N5OS/c12-11(13,14)5-1-2-6-7(3-5)21-10(18-6)19-9(20)17-4-8(15)16/h1-3H,4H2,(H3,15,16)(H2,17,18,19,20) |
| InChIKey | JKHVALKLXHRFDY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 103.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|