C16H10ClF3INO — CID 18809046
(E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-(4-iodophenyl)prop-2-enamide (PubChem CID 18809046) has the molecular formula C16H10ClF3INO and a molecular weight of 451.61 g/mol. Its IUPAC name is (E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-(4-iodophenyl)prop-2-enamide.
| Compound Name | (E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-(4-iodophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 18809046 |
| Molecular Formula | C16H10ClF3INO |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 450.94 |
| IUPAC Name | (E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-(4-iodophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(C(F)(F)F)ccc1Cl)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C16H10ClF3INO/c17-14-7-2-11(16(18,19)20)9-10(14)1-8-15(23)22-13-5-3-12(21)4-6-13/h1-9H,(H,22,23)/b8-1+ |
| InChIKey | RJMRLHQTYHFHLK-UNXLUWIOSA-N |
| XLogP | 5.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|