C18H10F2N2OS — CID 2150798
N-(4,6-difluoro-1,3-benzothiazol-2-yl)naphthalene-2-carboxamide (PubChem CID 2150798) has the molecular formula C18H10F2N2OS and a molecular weight of 340.35 g/mol. Its IUPAC name is N-(4,6-difluoro-1,3-benzothiazol-2-yl)naphthalene-2-carboxamide.
| Compound Name | N-(4,6-difluoro-1,3-benzothiazol-2-yl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 2150798 |
| Molecular Formula | C18H10F2N2OS |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | N-(4,6-difluoro-1,3-benzothiazol-2-yl)naphthalene-2-carboxamide |
| SMILES | O=C(Nc1nc2c(F)cc(F)cc2s1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H10F2N2OS/c19-13-8-14(20)16-15(9-13)24-18(21-16)22-17(23)12-6-5-10-3-1-2-4-11(10)7-12/h1-9H,(H,21,22,23) |
| InChIKey | BVFLLZLZCMXZRQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |