C20H11F3N2O3S — CID 23908095
[2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] naphthalene-2-carboxylate (PubChem CID 23908095) has the molecular formula C20H11F3N2O3S and a molecular weight of 416.38 g/mol. Its IUPAC name is [2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] naphthalene-2-carboxylate.
| Compound Name | [2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 23908095 |
| Molecular Formula | C20H11F3N2O3S |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | [2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] naphthalene-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2ccccc2c1)Nc1nc2c(F)c(F)c(F)cc2s1 |
| InChI | InChI=1S/C20H11F3N2O3S/c21-13-8-14-18(17(23)16(13)22)25-20(29-14)24-15(26)9-28-19(27)12-6-5-10-3-1-2-4-11(10)7-12/h1-8H,9H2,(H,24,25,26) |
| InChIKey | IGCXOAVEIJTGTG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|