C14H11F3N2O3S — CID 2391274
[2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] cyclobutanecarboxylate (PubChem CID 2391274) has the molecular formula C14H11F3N2O3S and a molecular weight of 344.31 g/mol. Its IUPAC name is [2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] cyclobutanecarboxylate.
| Compound Name | [2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] cyclobutanecarboxylate |
|---|---|
| PubChem CID | 2391274 |
| Molecular Formula | C14H11F3N2O3S |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | [2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] cyclobutanecarboxylate |
| SMILES | O=C(COC(=O)C1CCC1)Nc1nc2c(F)c(F)c(F)cc2s1 |
| InChI | InChI=1S/C14H11F3N2O3S/c15-7-4-8-12(11(17)10(7)16)19-14(23-8)18-9(20)5-22-13(21)6-2-1-3-6/h4,6H,1-3,5H2,(H,18,19,20) |
| InChIKey | JIXNDAUPSIIXCH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|