C14H9F3N2O5S — CID 8763397
[2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate (PubChem CID 8763397) has the molecular formula C14H9F3N2O5S and a molecular weight of 374.30 g/mol. Its IUPAC name is [2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate.
| Compound Name | [2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate |
|---|---|
| PubChem CID | 8763397 |
| Molecular Formula | C14H9F3N2O5S |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | [2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate |
| SMILES | O=C(COC(=O)C1=COCCO1)Nc1nc2c(F)c(F)c(F)cc2s1 |
| InChI | InChI=1S/C14H9F3N2O5S/c15-6-3-8-12(11(17)10(6)16)19-14(25-8)18-9(20)5-24-13(21)7-4-22-1-2-23-7/h3-4H,1-2,5H2,(H,18,19,20) |
| InChIKey | NIDXKWUBZUTYIW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|