C13H8F5NO5 — CID 8763450
[2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate (PubChem CID 8763450) has the molecular formula C13H8F5NO5 and a molecular weight of 353.20 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate.
| Compound Name | [2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate |
|---|---|
| PubChem CID | 8763450 |
| Molecular Formula | C13H8F5NO5 |
| Molecular Weight | 353.20 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | [2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate |
| SMILES | O=C(COC(=O)C1=COCCO1)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H8F5NO5/c14-7-8(15)10(17)12(11(18)9(7)16)19-6(20)4-24-13(21)5-3-22-1-2-23-5/h3H,1-2,4H2,(H,19,20) |
| InChIKey | COHWYOXUSCKMCH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.20 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|