C20H15ClF3N3O6S2 — CID 23828636
[2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] 4-chloro-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 23828636) has the molecular formula C20H15ClF3N3O6S2 and a molecular weight of 549.94 g/mol. Its IUPAC name is [2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] 4-chloro-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] 4-chloro-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 23828636 |
| Molecular Formula | C20H15ClF3N3O6S2 |
| Molecular Weight | 549.94 g/mol |
| Exact Mass | 549.00 |
| IUPAC Name | [2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] 4-chloro-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | O=C(COC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCOCC2)c1)Nc1nc2c(F)c(F)c(F)cc2s1 |
| InChI | InChI=1S/C20H15ClF3N3O6S2/c21-11-2-1-10(7-14(11)35(30,31)27-3-5-32-6-4-27)19(29)33-9-15(28)25-20-26-18-13(34-20)8-12(22)16(23)17(18)24/h1-2,7-8H,3-6,9H2,(H,25,26,28) |
| InChIKey | BTIMOMLKRNTUMS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.94 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|