C22H13F3N2O3S — CID 23761304
[2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] 4-phenylbenzoate (PubChem CID 23761304) has the molecular formula C22H13F3N2O3S and a molecular weight of 442.42 g/mol. Its IUPAC name is [2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] 4-phenylbenzoate.
| Compound Name | [2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 23761304 |
| Molecular Formula | C22H13F3N2O3S |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | [2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] 4-phenylbenzoate |
| SMILES | O=C(COC(=O)c1ccc(-c2ccccc2)cc1)Nc1nc2c(F)c(F)c(F)cc2s1 |
| InChI | InChI=1S/C22H13F3N2O3S/c23-15-10-16-20(19(25)18(15)24)27-22(31-16)26-17(28)11-30-21(29)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-10H,11H2,(H,26,27,28) |
| InChIKey | XUECOAJPYVTHRA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|