C18H10F3N3O3S — CID 8606062
[2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] 1H-indole-3-carboxylate (PubChem CID 8606062) has the molecular formula C18H10F3N3O3S and a molecular weight of 405.36 g/mol. Its IUPAC name is [2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] 1H-indole-3-carboxylate.
| Compound Name | [2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] 1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 8606062 |
| Molecular Formula | C18H10F3N3O3S |
| Molecular Weight | 405.36 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | [2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] 1H-indole-3-carboxylate |
| SMILES | O=C(COC(=O)c1c[nH]c2ccccc12)Nc1nc2c(F)c(F)c(F)cc2s1 |
| InChI | InChI=1S/C18H10F3N3O3S/c19-10-5-12-16(15(21)14(10)20)24-18(28-12)23-13(25)7-27-17(26)9-6-22-11-4-2-1-3-8(9)11/h1-6,22H,7H2,(H,23,24,25) |
| InChIKey | FLTONRLDSQRDRL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|