C16H9F3N2O4S — CID 7798207
[2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] 2-hydroxybenzoate (PubChem CID 7798207) has the molecular formula C16H9F3N2O4S and a molecular weight of 382.32 g/mol. Its IUPAC name is [2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] 2-hydroxybenzoate.
| Compound Name | [2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] 2-hydroxybenzoate |
|---|---|
| PubChem CID | 7798207 |
| Molecular Formula | C16H9F3N2O4S |
| Molecular Weight | 382.32 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | [2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] 2-hydroxybenzoate |
| SMILES | O=C(COC(=O)c1ccccc1O)Nc1nc2c(F)c(F)c(F)cc2s1 |
| InChI | InChI=1S/C16H9F3N2O4S/c17-8-5-10-14(13(19)12(8)18)21-16(26-10)20-11(23)6-25-15(24)7-3-1-2-4-9(7)22/h1-5,22H,6H2,(H,20,21,23) |
| InChIKey | SBCDTOFUUDSJIM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|