C14H6F3N3O6S — CID 2646308
[2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] 5-nitrofuran-2-carboxylate (PubChem CID 2646308) has the molecular formula C14H6F3N3O6S and a molecular weight of 401.28 g/mol. Its IUPAC name is [2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] 5-nitrofuran-2-carboxylate.
| Compound Name | [2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 2646308 |
| Molecular Formula | C14H6F3N3O6S |
| Molecular Weight | 401.28 g/mol |
| Exact Mass | 400.99 |
| IUPAC Name | [2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] 5-nitrofuran-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc([N+](=O)[O-])o1)Nc1nc2c(F)c(F)c(F)cc2s1 |
| InChI | InChI=1S/C14H6F3N3O6S/c15-5-3-7-12(11(17)10(5)16)19-14(27-7)18-8(21)4-25-13(22)6-1-2-9(26-6)20(23)24/h1-3H,4H2,(H,18,19,21) |
| InChIKey | RSEGCYVIKYXVLP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 124.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|