C20H17F4N3O5S2 — CID 23851830
[2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] 3-(diethylsulfamoyl)-4-fluorobenzoate (PubChem CID 23851830) has the molecular formula C20H17F4N3O5S2 and a molecular weight of 519.50 g/mol. Its IUPAC name is [2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] 3-(diethylsulfamoyl)-4-fluorobenzoate.
| Compound Name | [2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] 3-(diethylsulfamoyl)-4-fluorobenzoate |
|---|---|
| PubChem CID | 23851830 |
| Molecular Formula | C20H17F4N3O5S2 |
| Molecular Weight | 519.50 g/mol |
| Exact Mass | 519.05 |
| IUPAC Name | [2-oxo-2-[(4,5,6-trifluoro-1,3-benzothiazol-2-yl)amino]ethyl] 3-(diethylsulfamoyl)-4-fluorobenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)OCC(=O)Nc2nc3c(F)c(F)c(F)cc3s2)ccc1F |
| InChI | InChI=1S/C20H17F4N3O5S2/c1-3-27(4-2)34(30,31)14-7-10(5-6-11(14)21)19(29)32-9-15(28)25-20-26-18-13(33-20)8-12(22)16(23)17(18)24/h5-8H,3-4,9H2,1-2H3,(H,25,26,28) |
| InChIKey | QQDBELCWTNUHHH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|