C23H15ClN2O4S — CID 23791370
[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl] 2-(4-chlorobenzoyl)benzoate (PubChem CID 23791370) has the molecular formula C23H15ClN2O4S and a molecular weight of 450.90 g/mol. Its IUPAC name is [2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl] 2-(4-chlorobenzoyl)benzoate.
| Compound Name | [2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl] 2-(4-chlorobenzoyl)benzoate |
|---|---|
| PubChem CID | 23791370 |
| Molecular Formula | C23H15ClN2O4S |
| Molecular Weight | 450.90 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | [2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl] 2-(4-chlorobenzoyl)benzoate |
| SMILES | O=C(COC(=O)c1ccccc1C(=O)c1ccc(Cl)cc1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C23H15ClN2O4S/c24-15-11-9-14(10-12-15)21(28)16-5-1-2-6-17(16)22(29)30-13-20(27)26-23-25-18-7-3-4-8-19(18)31-23/h1-12H,13H2,(H,25,26,27) |
| InChIKey | JWELJOZZOWQTCY-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.90 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |