C16H12ClN3O3 — CID 7492901
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 1H-indole-3-carboxylate (PubChem CID 7492901) has the molecular formula C16H12ClN3O3 and a molecular weight of 329.74 g/mol. Its IUPAC name is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 1H-indole-3-carboxylate.
| Compound Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 7492901 |
| Molecular Formula | C16H12ClN3O3 |
| Molecular Weight | 329.74 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 1H-indole-3-carboxylate |
| SMILES | O=C(COC(=O)c1c[nH]c2ccccc12)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C16H12ClN3O3/c17-10-5-6-14(19-7-10)20-15(21)9-23-16(22)12-8-18-13-4-2-1-3-11(12)13/h1-8,18H,9H2,(H,19,20,21) |
| InChIKey | FFNRHKAEPUYUJF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.74 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |