C17H13ClN2O3S — CID 55426445
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 3-methyl-1-benzothiophene-2-carboxylate (PubChem CID 55426445) has the molecular formula C17H13ClN2O3S and a molecular weight of 360.82 g/mol. Its IUPAC name is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 3-methyl-1-benzothiophene-2-carboxylate.
| Compound Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 3-methyl-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 55426445 |
| Molecular Formula | C17H13ClN2O3S |
| Molecular Weight | 360.82 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 3-methyl-1-benzothiophene-2-carboxylate |
| SMILES | Cc1c(C(=O)OCC(=O)Nc2ccc(Cl)cn2)sc2ccccc12 |
| InChI | InChI=1S/C17H13ClN2O3S/c1-10-12-4-2-3-5-13(12)24-16(10)17(22)23-9-15(21)20-14-7-6-11(18)8-19-14/h2-8H,9H2,1H3,(H,19,20,21) |
| InChIKey | HJVZZNGWPZJKTE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.82 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |