C18H17F2N3OS — CID 171529922
N-(4,6-difluoro-1,3-benzothiazol-2-yl)-2-(N-methylanilino)butanamide (PubChem CID 171529922) has the molecular formula C18H17F2N3OS and a molecular weight of 361.42 g/mol. Its IUPAC name is N-(4,6-difluoro-1,3-benzothiazol-2-yl)-2-(N-methylanilino)butanamide.
| Compound Name | N-(4,6-difluoro-1,3-benzothiazol-2-yl)-2-(N-methylanilino)butanamide |
|---|---|
| PubChem CID | 171529922 |
| Molecular Formula | C18H17F2N3OS |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | N-(4,6-difluoro-1,3-benzothiazol-2-yl)-2-(N-methylanilino)butanamide |
| SMILES | CCC(C(=O)Nc1nc2c(F)cc(F)cc2s1)N(C)c1ccccc1 |
| InChI | InChI=1S/C18H17F2N3OS/c1-3-14(23(2)12-7-5-4-6-8-12)17(24)22-18-21-16-13(20)9-11(19)10-15(16)25-18/h4-10,14H,3H2,1-2H3,(H,21,22,24) |
| InChIKey | CEKSQIYYYHBESV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |