C17H14F2N2O3S — CID 9119417
N-(4,6-difluoro-1,3-benzothiazol-2-yl)-3-ethoxy-4-methoxybenzamide (PubChem CID 9119417) has the molecular formula C17H14F2N2O3S and a molecular weight of 364.37 g/mol. Its IUPAC name is N-(4,6-difluoro-1,3-benzothiazol-2-yl)-3-ethoxy-4-methoxybenzamide.
| Compound Name | N-(4,6-difluoro-1,3-benzothiazol-2-yl)-3-ethoxy-4-methoxybenzamide |
|---|---|
| PubChem CID | 9119417 |
| Molecular Formula | C17H14F2N2O3S |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | N-(4,6-difluoro-1,3-benzothiazol-2-yl)-3-ethoxy-4-methoxybenzamide |
| SMILES | CCOc1cc(C(=O)Nc2nc3c(F)cc(F)cc3s2)ccc1OC |
| InChI | InChI=1S/C17H14F2N2O3S/c1-3-24-13-6-9(4-5-12(13)23-2)16(22)21-17-20-15-11(19)7-10(18)8-14(15)25-17/h4-8H,3H2,1-2H3,(H,20,21,22) |
| InChIKey | WSYYVPRZWFVTPH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |