C16H11F2N3O5S — CID 43989050
N-(4,6-difluoro-1,3-benzothiazol-2-yl)-4,5-dimethoxy-2-nitrobenzamide (PubChem CID 43989050) has the molecular formula C16H11F2N3O5S and a molecular weight of 395.34 g/mol. Its IUPAC name is N-(4,6-difluoro-1,3-benzothiazol-2-yl)-4,5-dimethoxy-2-nitrobenzamide.
| Compound Name | N-(4,6-difluoro-1,3-benzothiazol-2-yl)-4,5-dimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 43989050 |
| Molecular Formula | C16H11F2N3O5S |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | N-(4,6-difluoro-1,3-benzothiazol-2-yl)-4,5-dimethoxy-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)Nc2nc3c(F)cc(F)cc3s2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C16H11F2N3O5S/c1-25-11-5-8(10(21(23)24)6-12(11)26-2)15(22)20-16-19-14-9(18)3-7(17)4-13(14)27-16/h3-6H,1-2H3,(H,19,20,22) |
| InChIKey | NTNMGXHANVMWNW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|