C18H14N4O5S3 — CID 90601795
4,5-dimethoxy-N-(2-methylsulfanyl-[1,3]thiazolo[4,5-g][1,3]benzothiazol-7-yl)-2-nitrobenzamide (PubChem CID 90601795) has the molecular formula C18H14N4O5S3 and a molecular weight of 462.53 g/mol. Its IUPAC name is 4,5-dimethoxy-N-(2-methylsulfanyl-[1,3]thiazolo[4,5-g][1,3]benzothiazol-7-yl)-2-nitrobenzamide.
| Compound Name | 4,5-dimethoxy-N-(2-methylsulfanyl-[1,3]thiazolo[4,5-g][1,3]benzothiazol-7-yl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 90601795 |
| Molecular Formula | C18H14N4O5S3 |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.01 |
| IUPAC Name | 4,5-dimethoxy-N-(2-methylsulfanyl-[1,3]thiazolo[4,5-g][1,3]benzothiazol-7-yl)-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)Nc2nc3ccc4nc(SC)sc4c3s2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H14N4O5S3/c1-26-12-6-8(11(22(24)25)7-13(12)27-2)16(23)21-17-19-9-4-5-10-15(14(9)29-17)30-18(20-10)28-3/h4-7H,1-3H3,(H,19,21,23) |
| InChIKey | OFFUMEBGUMZKMK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|