C18H15N3O7S — CID 42146077
N-(6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-yl)-4,5-dimethoxy-2-nitrobenzamide (PubChem CID 42146077) has the molecular formula C18H15N3O7S and a molecular weight of 417.40 g/mol. Its IUPAC name is N-(6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-yl)-4,5-dimethoxy-2-nitrobenzamide.
| Compound Name | N-(6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-yl)-4,5-dimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 42146077 |
| Molecular Formula | C18H15N3O7S |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | N-(6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-yl)-4,5-dimethoxy-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)Nc2nc3cc4c(cc3s2)OCCO4)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H15N3O7S/c1-25-12-5-9(11(21(23)24)7-13(12)26-2)17(22)20-18-19-10-6-14-15(8-16(10)29-18)28-4-3-27-14/h5-8H,3-4H2,1-2H3,(H,19,20,22) |
| InChIKey | UXXQGUXPBKFCRP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|