C20H20N4O7S — CID 55513732
N-(6-acetamido-1,3-benzothiazol-2-yl)-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide (PubChem CID 55513732) has the molecular formula C20H20N4O7S and a molecular weight of 460.47 g/mol. Its IUPAC name is N-(6-acetamido-1,3-benzothiazol-2-yl)-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide.
| Compound Name | N-(6-acetamido-1,3-benzothiazol-2-yl)-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide |
|---|---|
| PubChem CID | 55513732 |
| Molecular Formula | C20H20N4O7S |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | N-(6-acetamido-1,3-benzothiazol-2-yl)-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide |
| SMILES | COCCOc1cc([N+](=O)[O-])c(C(=O)Nc2nc3ccc(NC(C)=O)cc3s2)cc1OC |
| InChI | InChI=1S/C20H20N4O7S/c1-11(25)21-12-4-5-14-18(8-12)32-20(22-14)23-19(26)13-9-16(30-3)17(31-7-6-29-2)10-15(13)24(27)28/h4-5,8-10H,6-7H2,1-3H3,(H,21,25)(H,22,23,26) |
| InChIKey | REXQHJUPGKOWHK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 141.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|