C23H25N3O6S — CID 55688928
5-methoxy-4-(2-methoxyethoxy)-2-nitro-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)benzamide (PubChem CID 55688928) has the molecular formula C23H25N3O6S and a molecular weight of 471.54 g/mol. Its IUPAC name is 5-methoxy-4-(2-methoxyethoxy)-2-nitro-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 5-methoxy-4-(2-methoxyethoxy)-2-nitro-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 55688928 |
| Molecular Formula | C23H25N3O6S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 5-methoxy-4-(2-methoxyethoxy)-2-nitro-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)benzamide |
| SMILES | COCCOc1cc([N+](=O)[O-])c(C(=O)Nc2nc(-c3ccccc3)c(C(C)C)s2)cc1OC |
| InChI | InChI=1S/C23H25N3O6S/c1-14(2)21-20(15-8-6-5-7-9-15)24-23(33-21)25-22(27)16-12-18(31-4)19(32-11-10-30-3)13-17(16)26(28)29/h5-9,12-14H,10-11H2,1-4H3,(H,24,25,27) |
| InChIKey | UXBOQKHCTAWTNB-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|