C19H18N4O5S — CID 18203888
N-(5-benzyl-1,3,4-thiadiazol-2-yl)-4-ethoxy-5-methoxy-2-nitrobenzamide (PubChem CID 18203888) has the molecular formula C19H18N4O5S and a molecular weight of 414.44 g/mol. Its IUPAC name is N-(5-benzyl-1,3,4-thiadiazol-2-yl)-4-ethoxy-5-methoxy-2-nitrobenzamide.
| Compound Name | N-(5-benzyl-1,3,4-thiadiazol-2-yl)-4-ethoxy-5-methoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 18203888 |
| Molecular Formula | C19H18N4O5S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | N-(5-benzyl-1,3,4-thiadiazol-2-yl)-4-ethoxy-5-methoxy-2-nitrobenzamide |
| SMILES | CCOc1cc([N+](=O)[O-])c(C(=O)Nc2nnc(Cc3ccccc3)s2)cc1OC |
| InChI | InChI=1S/C19H18N4O5S/c1-3-28-16-11-14(23(25)26)13(10-15(16)27-2)18(24)20-19-22-21-17(29-19)9-12-7-5-4-6-8-12/h4-8,10-11H,3,9H2,1-2H3,(H,20,22,24) |
| InChIKey | CGGUUHNSFULMEJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|