C21H17N5O7S — CID 108744292
N-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3,4-thiadiazol-2-yl]-4,5-dimethoxy-2-nitrobenzamide (PubChem CID 108744292) has the molecular formula C21H17N5O7S and a molecular weight of 483.46 g/mol. Its IUPAC name is N-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3,4-thiadiazol-2-yl]-4,5-dimethoxy-2-nitrobenzamide.
| Compound Name | N-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3,4-thiadiazol-2-yl]-4,5-dimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 108744292 |
| Molecular Formula | C21H17N5O7S |
| Molecular Weight | 483.46 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | N-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3,4-thiadiazol-2-yl]-4,5-dimethoxy-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)Nc2nnc(CCN3C(=O)c4ccccc4C3=O)s2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C21H17N5O7S/c1-32-15-9-13(14(26(30)31)10-16(15)33-2)18(27)22-21-24-23-17(34-21)7-8-25-19(28)11-5-3-4-6-12(11)20(25)29/h3-6,9-10H,7-8H2,1-2H3,(H,22,24,27) |
| InChIKey | HUEDWUANVHQLCJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 153.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|