C16H15N7O6S3 — CID 23792202
4,5-dimethoxy-N-[5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-nitrobenzamide (PubChem CID 23792202) has the molecular formula C16H15N7O6S3 and a molecular weight of 497.54 g/mol. Its IUPAC name is 4,5-dimethoxy-N-[5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-nitrobenzamide.
| Compound Name | 4,5-dimethoxy-N-[5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 23792202 |
| Molecular Formula | C16H15N7O6S3 |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.02 |
| IUPAC Name | 4,5-dimethoxy-N-[5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)Nc2nnc(SCC(=O)Nc3nnc(C)s3)s2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C16H15N7O6S3/c1-7-19-20-14(31-7)17-12(24)6-30-16-22-21-15(32-16)18-13(25)8-4-10(28-2)11(29-3)5-9(8)23(26)27/h4-5H,6H2,1-3H3,(H,17,20,24)(H,18,21,25) |
| InChIKey | LBCLGDMPUMVJBT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 171.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|