C16H20N4O5S — CID 2218602
4,5-dimethoxy-2-nitro-N-[5-[(2S)-pentan-2-yl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 2218602) has the molecular formula C16H20N4O5S and a molecular weight of 380.43 g/mol. Its IUPAC name is 4,5-dimethoxy-2-nitro-N-[5-[(2S)-pentan-2-yl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4,5-dimethoxy-2-nitro-N-[5-[(2S)-pentan-2-yl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 2218602 |
| Molecular Formula | C16H20N4O5S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 4,5-dimethoxy-2-nitro-N-[5-[(2S)-pentan-2-yl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CCC[C@H](C)c1nnc(NC(=O)c2cc(OC)c(OC)cc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C16H20N4O5S/c1-5-6-9(2)15-18-19-16(26-15)17-14(21)10-7-12(24-3)13(25-4)8-11(10)20(22)23/h7-9H,5-6H2,1-4H3,(H,17,19,21)/t9-/m0/s1 |
| InChIKey | ASHPPHQDXCBFGR-VIFPVBQESA-N |
| XLogP | 3.62 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|