C26H37ClN4O6S — CID 161085377
tert-butyl 8-[2-chloro-5-nitro-4-[(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)carbamoyl]phenoxy]octanoate (PubChem CID 161085377) has the molecular formula C26H37ClN4O6S and a molecular weight of 569.12 g/mol. Its IUPAC name is tert-butyl 8-[2-chloro-5-nitro-4-[(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)carbamoyl]phenoxy]octanoate.
| Compound Name | tert-butyl 8-[2-chloro-5-nitro-4-[(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)carbamoyl]phenoxy]octanoate |
|---|---|
| PubChem CID | 161085377 |
| Molecular Formula | C26H37ClN4O6S |
| Molecular Weight | 569.12 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | tert-butyl 8-[2-chloro-5-nitro-4-[(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)carbamoyl]phenoxy]octanoate |
| SMILES | CCC(CC)c1nnc(NC(=O)c2cc(Cl)c(OCCCCCCCC(=O)OC(C)(C)C)cc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C26H37ClN4O6S/c1-6-17(7-2)24-29-30-25(38-24)28-23(33)18-15-19(27)21(16-20(18)31(34)35)36-14-12-10-8-9-11-13-22(32)37-26(3,4)5/h15-17H,6-14H2,1-5H3,(H,28,30,33) |
| InChIKey | UGLAEQJRTTVMAP-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.12 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|