About 1-chloro-4-nitro-2,5-dioctoxybenzene
1-chloro-4-nitro-2,5-dioctoxybenzene (PubChem CID 19040188) has the molecular formula C22H36ClNO4
and a molecular weight of 413.99 g/mol. Its IUPAC name is 1-chloro-4-nitro-2,5-dioctoxybenzene.
Molecular Properties
| Compound Name | 1-chloro-4-nitro-2,5-dioctoxybenzene |
| PubChem CID | 19040188 |
| Molecular Formula | C22H36ClNO4 |
| Molecular Weight | 413.99 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | 1-chloro-4-nitro-2,5-dioctoxybenzene |
| SMILES | CCCCCCCCOc1cc([N+](=O)[O-])c(OCCCCCCCC)cc1Cl |
| InChI | InChI=1S/C22H36ClNO4/c1-3-5-7-9-11-13-15-27-21-18-20(24(25)26)22(17-19(21)23)28-16-14-12-10-8-6-4-2/h17-18H,3-16H2,1-2H3 |
| InChIKey | JZUXDMUZRYIUOC-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.99 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-4-nitro-2,5-dioctoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-nitro-2,5-dioctoxybenzene?
The IUPAC name of 1-chloro-4-nitro-2,5-dioctoxybenzene (CID 19040188) is 1-chloro-4-nitro-2,5-dioctoxybenzene.
What is the SMILES notation for 1-chloro-4-nitro-2,5-dioctoxybenzene?
The canonical SMILES for 1-chloro-4-nitro-2,5-dioctoxybenzene is CCCCCCCCOc1cc([N+](=O)[O-])c(OCCCCCCCC)cc1Cl.
What is the InChIKey of 1-chloro-4-nitro-2,5-dioctoxybenzene?
The InChIKey is JZUXDMUZRYIUOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H36ClNO4/c1-3-5-7-9-11-13-15-27-21-18-20(24(25)26)22(17-19(21)23)28-16-14-12-10-8-6-4-2/h17-18H,3-16H2,1-2H3.
What are the key properties of 1-chloro-4-nitro-2,5-dioctoxybenzene?
1-chloro-4-nitro-2,5-dioctoxybenzene has a molecular weight of 413.99 g/mol, XLogP of 7.73, 17 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-nitro-2,5-dioctoxybenzene is sourced from PubChem (CID 19040188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).