C10H10Cl3NO5S — CID 107501718
4-(4,5-dichloro-2-nitrophenoxy)butane-1-sulfonyl chloride (PubChem CID 107501718) has the molecular formula C10H10Cl3NO5S and a molecular weight of 362.62 g/mol. Its IUPAC name is 4-(4,5-dichloro-2-nitrophenoxy)butane-1-sulfonyl chloride.
| Compound Name | 4-(4,5-dichloro-2-nitrophenoxy)butane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 107501718 |
| Molecular Formula | C10H10Cl3NO5S |
| Molecular Weight | 362.62 g/mol |
| Exact Mass | 360.93 |
| IUPAC Name | 4-(4,5-dichloro-2-nitrophenoxy)butane-1-sulfonyl chloride |
| SMILES | O=[N+]([O-])c1cc(Cl)c(Cl)cc1OCCCCS(=O)(=O)Cl |
| InChI | InChI=1S/C10H10Cl3NO5S/c11-7-5-9(14(15)16)10(6-8(7)12)19-3-1-2-4-20(13,17)18/h5-6H,1-4H2 |
| InChIKey | DJOFVSLRGUCOQY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.62 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|