C10H11Cl2NO4S — CID 107501777
2-[2-(4,5-dichloro-2-nitrophenoxy)ethoxy]ethanethiol (PubChem CID 107501777) has the molecular formula C10H11Cl2NO4S and a molecular weight of 312.17 g/mol. Its IUPAC name is 2-[2-(4,5-dichloro-2-nitrophenoxy)ethoxy]ethanethiol.
| Compound Name | 2-[2-(4,5-dichloro-2-nitrophenoxy)ethoxy]ethanethiol |
|---|---|
| PubChem CID | 107501777 |
| Molecular Formula | C10H11Cl2NO4S |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 310.98 |
| IUPAC Name | 2-[2-(4,5-dichloro-2-nitrophenoxy)ethoxy]ethanethiol |
| SMILES | O=[N+]([O-])c1cc(Cl)c(Cl)cc1OCCOCCS |
| InChI | InChI=1S/C10H11Cl2NO4S/c11-7-5-9(13(14)15)10(6-8(7)12)17-2-1-16-3-4-18/h5-6,18H,1-4H2 |
| InChIKey | ZZJYXNSFFMXDOR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|