C10H11BrCl2O2S — CID 107662391
2-[2-(4-bromo-2,5-dichlorophenoxy)ethoxy]ethanethiol (PubChem CID 107662391) has the molecular formula C10H11BrCl2O2S and a molecular weight of 346.07 g/mol. Its IUPAC name is 2-[2-(4-bromo-2,5-dichlorophenoxy)ethoxy]ethanethiol.
| Compound Name | 2-[2-(4-bromo-2,5-dichlorophenoxy)ethoxy]ethanethiol |
|---|---|
| PubChem CID | 107662391 |
| Molecular Formula | C10H11BrCl2O2S |
| Molecular Weight | 346.07 g/mol |
| Exact Mass | 343.90 |
| IUPAC Name | 2-[2-(4-bromo-2,5-dichlorophenoxy)ethoxy]ethanethiol |
| SMILES | SCCOCCOc1cc(Cl)c(Br)cc1Cl |
| InChI | InChI=1S/C10H11BrCl2O2S/c11-7-5-9(13)10(6-8(7)12)15-2-1-14-3-4-16/h5-6,16H,1-4H2 |
| InChIKey | PAWZTAKWDFBNOM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.07 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|