C10H12BrCl2NO — CID 107659698
3-(4-bromo-2,5-dichlorophenoxy)-2-methylpropan-1-amine (PubChem CID 107659698) has the molecular formula C10H12BrCl2NO and a molecular weight of 313.02 g/mol. Its IUPAC name is 3-(4-bromo-2,5-dichlorophenoxy)-2-methylpropan-1-amine.
| Compound Name | 3-(4-bromo-2,5-dichlorophenoxy)-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 107659698 |
| Molecular Formula | C10H12BrCl2NO |
| Molecular Weight | 313.02 g/mol |
| Exact Mass | 310.95 |
| IUPAC Name | 3-(4-bromo-2,5-dichlorophenoxy)-2-methylpropan-1-amine |
| SMILES | CC(CN)COc1cc(Cl)c(Br)cc1Cl |
| InChI | InChI=1S/C10H12BrCl2NO/c1-6(4-14)5-15-10-3-8(12)7(11)2-9(10)13/h2-3,6H,4-5,14H2,1H3 |
| InChIKey | XITXMYBLXMMOIP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.02 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|