C12H15BrCl2N2O — CID 107658281
1-[2-(4-bromo-2,5-dichlorophenoxy)ethyl]piperazine (PubChem CID 107658281) has the molecular formula C12H15BrCl2N2O and a molecular weight of 354.08 g/mol. Its IUPAC name is 1-[2-(4-bromo-2,5-dichlorophenoxy)ethyl]piperazine.
| Compound Name | 1-[2-(4-bromo-2,5-dichlorophenoxy)ethyl]piperazine |
|---|---|
| PubChem CID | 107658281 |
| Molecular Formula | C12H15BrCl2N2O |
| Molecular Weight | 354.08 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | 1-[2-(4-bromo-2,5-dichlorophenoxy)ethyl]piperazine |
| SMILES | Clc1cc(OCCN2CCNCC2)c(Cl)cc1Br |
| InChI | InChI=1S/C12H15BrCl2N2O/c13-9-7-11(15)12(8-10(9)14)18-6-5-17-3-1-16-2-4-17/h7-8,16H,1-6H2 |
| InChIKey | LFCKVOYDVLXENO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.08 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|