C9H7Cl2NO4 — CID 107500535
3-(4,5-dichloro-2-nitrophenoxy)propanal (PubChem CID 107500535) has the molecular formula C9H7Cl2NO4 and a molecular weight of 264.06 g/mol. Its IUPAC name is 3-(4,5-dichloro-2-nitrophenoxy)propanal.
| Compound Name | 3-(4,5-dichloro-2-nitrophenoxy)propanal |
|---|---|
| PubChem CID | 107500535 |
| Molecular Formula | C9H7Cl2NO4 |
| Molecular Weight | 264.06 g/mol |
| Exact Mass | 262.98 |
| IUPAC Name | 3-(4,5-dichloro-2-nitrophenoxy)propanal |
| SMILES | O=CCCOc1cc(Cl)c(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H7Cl2NO4/c10-6-4-8(12(14)15)9(5-7(6)11)16-3-1-2-13/h2,4-5H,1,3H2 |
| InChIKey | WCSPTQFTSOKUQZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.06 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|