C10H9Cl2NO4 — CID 107499464
2-[(4,5-dichloro-2-nitrophenoxy)methyl]-2-methyloxirane (PubChem CID 107499464) has the molecular formula C10H9Cl2NO4 and a molecular weight of 278.09 g/mol. Its IUPAC name is 2-[(4,5-dichloro-2-nitrophenoxy)methyl]-2-methyloxirane.
| Compound Name | 2-[(4,5-dichloro-2-nitrophenoxy)methyl]-2-methyloxirane |
|---|---|
| PubChem CID | 107499464 |
| Molecular Formula | C10H9Cl2NO4 |
| Molecular Weight | 278.09 g/mol |
| Exact Mass | 276.99 |
| IUPAC Name | 2-[(4,5-dichloro-2-nitrophenoxy)methyl]-2-methyloxirane |
| SMILES | CC1(COc2cc(Cl)c(Cl)cc2[N+](=O)[O-])CO1 |
| InChI | InChI=1S/C10H9Cl2NO4/c1-10(5-17-10)4-16-9-3-7(12)6(11)2-8(9)13(14)15/h2-3H,4-5H2,1H3 |
| InChIKey | RWIVYYIEJDNPMX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 64.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.09 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|