C12H14Cl2N2O4 — CID 102634870
2-[(4,5-dichloro-2-nitrophenoxy)methyl]-6-methylmorpholine (PubChem CID 102634870) has the molecular formula C12H14Cl2N2O4 and a molecular weight of 321.16 g/mol. Its IUPAC name is 2-[(4,5-dichloro-2-nitrophenoxy)methyl]-6-methylmorpholine.
| Compound Name | 2-[(4,5-dichloro-2-nitrophenoxy)methyl]-6-methylmorpholine |
|---|---|
| PubChem CID | 102634870 |
| Molecular Formula | C12H14Cl2N2O4 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 2-[(4,5-dichloro-2-nitrophenoxy)methyl]-6-methylmorpholine |
| SMILES | CC1CNCC(COc2cc(Cl)c(Cl)cc2[N+](=O)[O-])O1 |
| InChI | InChI=1S/C12H14Cl2N2O4/c1-7-4-15-5-8(20-7)6-19-12-3-10(14)9(13)2-11(12)16(17)18/h2-3,7-8,15H,4-6H2,1H3 |
| InChIKey | FOZFDFGDCQTOES-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|