C11H10Cl2N2O5 — CID 107499259
2-[3-(4,5-dichloro-2-nitrophenoxy)azetidin-3-yl]acetic acid (PubChem CID 107499259) has the molecular formula C11H10Cl2N2O5 and a molecular weight of 321.12 g/mol. Its IUPAC name is 2-[3-(4,5-dichloro-2-nitrophenoxy)azetidin-3-yl]acetic acid.
| Compound Name | 2-[3-(4,5-dichloro-2-nitrophenoxy)azetidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 107499259 |
| Molecular Formula | C11H10Cl2N2O5 |
| Molecular Weight | 321.12 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | 2-[3-(4,5-dichloro-2-nitrophenoxy)azetidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1(Oc2cc(Cl)c(Cl)cc2[N+](=O)[O-])CNC1 |
| InChI | InChI=1S/C11H10Cl2N2O5/c12-6-1-8(15(18)19)9(2-7(6)13)20-11(3-10(16)17)4-14-5-11/h1-2,14H,3-5H2,(H,16,17) |
| InChIKey | CTLFVOCXVKUEKK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.12 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|