C8H4Cl2NO4- — CID 6994184
2-(4,5-dichloro-2-nitrophenyl)acetate (PubChem CID 6994184) has the molecular formula C8H4Cl2NO4- and a molecular weight of 249.03 g/mol. Its IUPAC name is 2-(4,5-dichloro-2-nitrophenyl)acetate.
| Compound Name | 2-(4,5-dichloro-2-nitrophenyl)acetate |
|---|---|
| PubChem CID | 6994184 |
| Molecular Formula | C8H4Cl2NO4- |
| Molecular Weight | 249.03 g/mol |
| Exact Mass | 247.95 |
| IUPAC Name | 2-(4,5-dichloro-2-nitrophenyl)acetate |
| SMILES | O=C([O-])Cc1cc(Cl)c(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H5Cl2NO4/c9-5-1-4(2-8(12)13)7(11(14)15)3-6(5)10/h1,3H,2H2,(H,12,13)/p-1 |
| InChIKey | NIBVBDGBJQMRNF-UHFFFAOYSA-M |
| XLogP | 1.19 |
| TPSA | 83.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.03 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|