C9H9ClN2O4 — CID 58056273
1-chloro-2,4-dinitro-5-propylbenzene (PubChem CID 58056273) has the molecular formula C9H9ClN2O4 and a molecular weight of 244.63 g/mol. Its IUPAC name is 1-chloro-2,4-dinitro-5-propylbenzene.
| Compound Name | 1-chloro-2,4-dinitro-5-propylbenzene |
|---|---|
| PubChem CID | 58056273 |
| Molecular Formula | C9H9ClN2O4 |
| Molecular Weight | 244.63 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 1-chloro-2,4-dinitro-5-propylbenzene |
| SMILES | CCCc1cc(Cl)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9ClN2O4/c1-2-3-6-4-7(10)9(12(15)16)5-8(6)11(13)14/h4-5H,2-3H2,1H3 |
| InChIKey | FLCJBLNMBGODTI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.63 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|