C11H9Cl2NO5 — CID 10733409
ethyl 3-(4,5-dichloro-2-nitrophenyl)-2-oxopropanoate (PubChem CID 10733409) has the molecular formula C11H9Cl2NO5 and a molecular weight of 306.10 g/mol. Its IUPAC name is ethyl 3-(4,5-dichloro-2-nitrophenyl)-2-oxopropanoate.
| Compound Name | ethyl 3-(4,5-dichloro-2-nitrophenyl)-2-oxopropanoate |
|---|---|
| PubChem CID | 10733409 |
| Molecular Formula | C11H9Cl2NO5 |
| Molecular Weight | 306.10 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | ethyl 3-(4,5-dichloro-2-nitrophenyl)-2-oxopropanoate |
| SMILES | CCOC(=O)C(=O)Cc1cc(Cl)c(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H9Cl2NO5/c1-2-19-11(16)10(15)4-6-3-7(12)8(13)5-9(6)14(17)18/h3,5H,2,4H2,1H3 |
| InChIKey | WQKSDNNSQJXXAL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.10 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|