C10H8Cl2N2O5 — CID 19990414
ethyl 2-(2-amino-3,4-dichloro-6-nitrophenyl)-2-oxoacetate (PubChem CID 19990414) has the molecular formula C10H8Cl2N2O5 and a molecular weight of 307.09 g/mol. Its IUPAC name is ethyl 2-(2-amino-3,4-dichloro-6-nitrophenyl)-2-oxoacetate.
| Compound Name | ethyl 2-(2-amino-3,4-dichloro-6-nitrophenyl)-2-oxoacetate |
|---|---|
| PubChem CID | 19990414 |
| Molecular Formula | C10H8Cl2N2O5 |
| Molecular Weight | 307.09 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | ethyl 2-(2-amino-3,4-dichloro-6-nitrophenyl)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1c([N+](=O)[O-])cc(Cl)c(Cl)c1N |
| InChI | InChI=1S/C10H8Cl2N2O5/c1-2-19-10(16)9(15)6-5(14(17)18)3-4(11)7(12)8(6)13/h3H,2,13H2,1H3 |
| InChIKey | JTIBCLGLGPAIEC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.09 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|