C14H13ClN2O8 — CID 88680250
ethyl 2-(5-chloro-2,4-dinitrobenzoyl)-3-ethoxyprop-2-enoate (PubChem CID 88680250) has the molecular formula C14H13ClN2O8 and a molecular weight of 372.72 g/mol. Its IUPAC name is ethyl 2-(5-chloro-2,4-dinitrobenzoyl)-3-ethoxyprop-2-enoate.
| Compound Name | ethyl 2-(5-chloro-2,4-dinitrobenzoyl)-3-ethoxyprop-2-enoate |
|---|---|
| PubChem CID | 88680250 |
| Molecular Formula | C14H13ClN2O8 |
| Molecular Weight | 372.72 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | ethyl 2-(5-chloro-2,4-dinitrobenzoyl)-3-ethoxyprop-2-enoate |
| SMILES | CCOC=C(C(=O)OCC)C(=O)c1cc(Cl)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H13ClN2O8/c1-3-24-7-9(14(19)25-4-2)13(18)8-5-10(15)12(17(22)23)6-11(8)16(20)21/h5-7H,3-4H2,1-2H3 |
| InChIKey | FITNXCCBSPTJIH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.72 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|