C13H12Cl3NO4 — CID 18973152
ethyl (Z)-3-ethoxy-2-(4,5,6-trichloropyridine-3-carbonyl)prop-2-enoate (PubChem CID 18973152) has the molecular formula C13H12Cl3NO4 and a molecular weight of 352.60 g/mol. Its IUPAC name is ethyl (Z)-3-ethoxy-2-(4,5,6-trichloropyridine-3-carbonyl)prop-2-enoate.
| Compound Name | ethyl (Z)-3-ethoxy-2-(4,5,6-trichloropyridine-3-carbonyl)prop-2-enoate |
|---|---|
| PubChem CID | 18973152 |
| Molecular Formula | C13H12Cl3NO4 |
| Molecular Weight | 352.60 g/mol |
| Exact Mass | 350.98 |
| IUPAC Name | ethyl (Z)-3-ethoxy-2-(4,5,6-trichloropyridine-3-carbonyl)prop-2-enoate |
| SMILES | CCO/C=C(\C(=O)OCC)C(=O)c1cnc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C13H12Cl3NO4/c1-3-20-6-8(13(19)21-4-2)11(18)7-5-17-12(16)10(15)9(7)14/h5-6H,3-4H2,1-2H3/b8-6- |
| InChIKey | UNSVGSBLGSKBGV-VURMDHGXSA-N |
| XLogP | 3.71 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.60 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|